C24H19ClN4O3S — CID 2084367
N-(4-acetamidophenyl)-2-(7-chloro-4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide (PubChem CID 2084367) has the molecular formula C24H19ClN4O3S and a molecular weight of 478.96 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-(7-chloro-4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-acetamidophenyl)-2-(7-chloro-4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 2084367 |
| Molecular Formula | C24H19ClN4O3S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-(4-acetamidophenyl)-2-(7-chloro-4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2nc3cc(Cl)ccc3c(=O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19ClN4O3S/c1-15(30)26-17-8-10-18(11-9-17)27-22(31)14-33-24-28-21-13-16(25)7-12-20(21)23(32)29(24)19-5-3-2-4-6-19/h2-13H,14H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | HSTALXMBDZFACV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |