C22H17FN4O4S2 — CID 4842171
2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-sulfamoylphenyl)acetamide (PubChem CID 4842171) has the molecular formula C22H17FN4O4S2 and a molecular weight of 484.53 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 4842171 |
| Molecular Formula | C22H17FN4O4S2 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CSc2nc3ccccc3c(=O)n2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H17FN4O4S2/c23-14-5-9-16(10-6-14)27-21(29)18-3-1-2-4-19(18)26-22(27)32-13-20(28)25-15-7-11-17(12-8-15)33(24,30)31/h1-12H,13H2,(H,25,28)(H2,24,30,31) |
| InChIKey | XTHXLLCGTQWPLU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |