C23H20N4O4S2 — CID 41498514
2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 41498514) has the molecular formula C23H20N4O4S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 41498514 |
| Molecular Formula | C23H20N4O4S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3cccc(S(N)(=O)=O)c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H20N4O4S2/c1-15-9-11-17(12-10-15)27-22(29)19-7-2-3-8-20(19)26-23(27)32-14-21(28)25-16-5-4-6-18(13-16)33(24,30)31/h2-13H,14H2,1H3,(H,25,28)(H2,24,30,31) |
| InChIKey | LKHPODRFTDAIKJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |