C18H18N4O4S2 — CID 55752458
2-(3,6-dimethyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 55752458) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-(3,6-dimethyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(3,6-dimethyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 55752458 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-(3,6-dimethyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | Cc1ccc2nc(SCC(=O)Nc3cccc(S(N)(=O)=O)c3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C18H18N4O4S2/c1-11-6-7-15-14(8-11)17(24)22(2)18(21-15)27-10-16(23)20-12-4-3-5-13(9-12)28(19,25)26/h3-9H,10H2,1-2H3,(H,20,23)(H2,19,25,26) |
| InChIKey | ADQKSVCAWMIWSE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |