C19H19N3O3S2 — CID 7363718
2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 7363718) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 7363718 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | Cc1cc(SCC(=O)Nc2cccc(S(N)(=O)=O)c2)nc2c(C)cccc12 |
| InChI | InChI=1S/C19H19N3O3S2/c1-12-5-3-8-16-13(2)9-18(22-19(12)16)26-11-17(23)21-14-6-4-7-15(10-14)27(20,24)25/h3-10H,11H2,1-2H3,(H,21,23)(H2,20,24,25) |
| InChIKey | JYNSSICJHMVFPK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |