C13H13N3O3S2 — CID 3911051
2-pyridin-2-ylsulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 3911051) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-pyridin-2-ylsulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-pyridin-2-ylsulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 3911051 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-pyridin-2-ylsulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)CSc2ccccn2)c1 |
| InChI | InChI=1S/C13H13N3O3S2/c14-21(18,19)11-5-3-4-10(8-11)16-12(17)9-20-13-6-1-2-7-15-13/h1-8H,9H2,(H,16,17)(H2,14,18,19) |
| InChIKey | CCMAEPTVLVEFJV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |