C15H15BrN2O3S2 — CID 5091800
2-(4-bromo-2-methylphenyl)sulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 5091800) has the molecular formula C15H15BrN2O3S2 and a molecular weight of 415.33 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 5091800 |
| Molecular Formula | C15H15BrN2O3S2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | Cc1cc(Br)ccc1SCC(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H15BrN2O3S2/c1-10-7-11(16)5-6-14(10)22-9-15(19)18-12-3-2-4-13(8-12)23(17,20)21/h2-8H,9H2,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | RDZFLZZZRZMRHF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |