C16H17BrN2O3S2 — CID 24635386
2-(4-bromo-2-methylphenyl)sulfanyl-N-[4-(methylsulfamoyl)phenyl]acetamide (PubChem CID 24635386) has the molecular formula C16H17BrN2O3S2 and a molecular weight of 429.36 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-[4-(methylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-[4-(methylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24635386 |
| Molecular Formula | C16H17BrN2O3S2 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-[4-(methylsulfamoyl)phenyl]acetamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)CSc2ccc(Br)cc2C)cc1 |
| InChI | InChI=1S/C16H17BrN2O3S2/c1-11-9-12(17)3-8-15(11)23-10-16(20)19-13-4-6-14(7-5-13)24(21,22)18-2/h3-9,18H,10H2,1-2H3,(H,19,20) |
| InChIKey | FQIMDHNKJFGENW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |