C18H18BrNO4S — CID 55709184
methyl 2-[4-[[2-(4-bromo-2-methylphenyl)sulfanylacetyl]amino]phenoxy]acetate (PubChem CID 55709184) has the molecular formula C18H18BrNO4S and a molecular weight of 424.32 g/mol. Its IUPAC name is methyl 2-[4-[[2-(4-bromo-2-methylphenyl)sulfanylacetyl]amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[[2-(4-bromo-2-methylphenyl)sulfanylacetyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 55709184 |
| Molecular Formula | C18H18BrNO4S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | methyl 2-[4-[[2-(4-bromo-2-methylphenyl)sulfanylacetyl]amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)CSc2ccc(Br)cc2C)cc1 |
| InChI | InChI=1S/C18H18BrNO4S/c1-12-9-13(19)3-8-16(12)25-11-17(21)20-14-4-6-15(7-5-14)24-10-18(22)23-2/h3-9H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | YSLNTZIDRCJBSQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |