C24H22N4O3S2 — CID 46806459
2-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 46806459) has the molecular formula C24H22N4O3S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 46806459 |
| Molecular Formula | C24H22N4O3S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 2-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)cnc2SCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C24H22N4O3S2/c1-17-10-12-20(13-11-17)28-22(18-6-3-2-4-7-18)15-26-24(28)32-16-23(29)27-19-8-5-9-21(14-19)33(25,30)31/h2-15H,16H2,1H3,(H,27,29)(H2,25,30,31) |
| InChIKey | MAMKZYUSTYNHKK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |