C19H18N4O5S2 — CID 43026666
[2-oxo-2-(3-sulfamoylanilino)ethyl] 2-methylsulfanyl-3-phenylimidazole-4-carboxylate (PubChem CID 43026666) has the molecular formula C19H18N4O5S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-methylsulfanyl-3-phenylimidazole-4-carboxylate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-methylsulfanyl-3-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 43026666 |
| Molecular Formula | C19H18N4O5S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-methylsulfanyl-3-phenylimidazole-4-carboxylate |
| SMILES | CSc1ncc(C(=O)OCC(=O)Nc2cccc(S(N)(=O)=O)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C19H18N4O5S2/c1-29-19-21-11-16(23(19)14-7-3-2-4-8-14)18(25)28-12-17(24)22-13-6-5-9-15(10-13)30(20,26)27/h2-11H,12H2,1H3,(H,22,24)(H2,20,26,27) |
| InChIKey | RYTQGAJOUITVFN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |