C22H18N4O5S2 — CID 4966178
[2-oxo-2-(3-sulfamoylanilino)ethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 4966178) has the molecular formula C22H18N4O5S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 4966178 |
| Molecular Formula | C22H18N4O5S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)c2cc(-c3cccs3)nn2-c2ccccc2)c1 |
| InChI | InChI=1S/C22H18N4O5S2/c23-33(29,30)17-9-4-6-15(12-17)24-21(27)14-31-22(28)19-13-18(20-10-5-11-32-20)25-26(19)16-7-2-1-3-8-16/h1-13H,14H2,(H,24,27)(H2,23,29,30) |
| InChIKey | YKFXPDSMGKRLGP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |