C23H15ClN4O3S — CID 16503741
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 16503741) has the molecular formula C23H15ClN4O3S and a molecular weight of 462.92 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 16503741 |
| Molecular Formula | C23H15ClN4O3S |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)c2cc(-c3cccs3)nn2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H15ClN4O3S/c24-18-11-16(9-8-15(18)13-25)26-22(29)14-31-23(30)20-12-19(21-7-4-10-32-21)27-28(20)17-5-2-1-3-6-17/h1-12H,14H2,(H,26,29) |
| InChIKey | NASVLSGFIQXPOF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |