C24H19N3O4S — CID 16503754
[2-(2-acetylanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 16503754) has the molecular formula C24H19N3O4S and a molecular weight of 445.50 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 16503754 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)c1cc(-c2cccs2)nn1-c1ccccc1 |
| InChI | InChI=1S/C24H19N3O4S/c1-16(28)18-10-5-6-11-19(18)25-23(29)15-31-24(30)21-14-20(22-12-7-13-32-22)26-27(21)17-8-3-2-4-9-17/h2-14H,15H2,1H3,(H,25,29) |
| InChIKey | BHIOYKCXRYGNPH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |