C21H23N3O3S — CID 16503750
[2-oxo-2-(pentan-2-ylamino)ethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 16503750) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is [2-oxo-2-(pentan-2-ylamino)ethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate.
| Compound Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 16503750 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | CCCC(C)NC(=O)COC(=O)c1cc(-c2cccs2)nn1-c1ccccc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-3-8-15(2)22-20(25)14-27-21(26)18-13-17(19-11-7-12-28-19)23-24(18)16-9-5-4-6-10-16/h4-7,9-13,15H,3,8,14H2,1-2H3,(H,22,25) |
| InChIKey | XFTNSVIDQCTCQV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |