C22H16ClN3O3S — CID 18274055
[2-(2-chloroanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 18274055) has the molecular formula C22H16ClN3O3S and a molecular weight of 437.91 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 18274055 |
| Molecular Formula | C22H16ClN3O3S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccs2)nn1-c1ccccc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H16ClN3O3S/c23-16-9-4-5-10-17(16)24-21(27)14-29-22(28)19-13-18(20-11-6-12-30-20)25-26(19)15-7-2-1-3-8-15/h1-13H,14H2,(H,24,27) |
| InChIKey | LBFQLQSYLDOZOL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |