C18H16N2O3S — CID 16503779
3-oxobutan-2-yl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 16503779) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-oxobutan-2-yl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate.
| Compound Name | 3-oxobutan-2-yl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 16503779 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-oxobutan-2-yl 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | CC(=O)C(C)OC(=O)c1cc(-c2cccs2)nn1-c1ccccc1 |
| InChI | InChI=1S/C18H16N2O3S/c1-12(21)13(2)23-18(22)16-11-15(17-9-6-10-24-17)19-20(16)14-7-4-3-5-8-14/h3-11,13H,1-2H3 |
| InChIKey | RYZDDLGWHHTOBI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |