C17H13N3O2S — CID 7214590
[(1S)-1-cyanoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 7214590) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate.
| Compound Name | [(1S)-1-cyanoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 7214590 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | [(1S)-1-cyanoethyl] 1-phenyl-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | C[C@@H](C#N)OC(=O)c1cc(-c2cccs2)nn1-c1ccccc1 |
| InChI | InChI=1S/C17H13N3O2S/c1-12(11-18)22-17(21)15-10-14(16-8-5-9-23-16)19-20(15)13-6-3-2-4-7-13/h2-10,12H,1H3/t12-/m0/s1 |
| InChIKey | MFDNZCJAFBKSEF-LBPRGKRZSA-N |
| XLogP | 3.67 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |