C25H17ClN4O4 — CID 42973141
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-benzyl-4-oxophthalazine-1-carboxylate (PubChem CID 42973141) has the molecular formula C25H17ClN4O4 and a molecular weight of 472.89 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-benzyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-benzyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 42973141 |
| Molecular Formula | C25H17ClN4O4 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-benzyl-4-oxophthalazine-1-carboxylate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C25H17ClN4O4/c26-21-12-18(11-10-17(21)13-27)28-22(31)15-34-25(33)23-19-8-4-5-9-20(19)24(32)30(29-23)14-16-6-2-1-3-7-16/h1-12H,14-15H2,(H,28,31) |
| InChIKey | WIPDRDLXTKCGCJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |