C24H19N3O4 — CID 7191321
(2-anilino-2-oxoethyl) 3-benzyl-4-oxophthalazine-1-carboxylate (PubChem CID 7191321) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 3-benzyl-4-oxophthalazine-1-carboxylate.
| Compound Name | (2-anilino-2-oxoethyl) 3-benzyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7191321 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (2-anilino-2-oxoethyl) 3-benzyl-4-oxophthalazine-1-carboxylate |
| SMILES | O=C(COC(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12)Nc1ccccc1 |
| InChI | InChI=1S/C24H19N3O4/c28-21(25-18-11-5-2-6-12-18)16-31-24(30)22-19-13-7-8-14-20(19)23(29)27(26-22)15-17-9-3-1-4-10-17/h1-14H,15-16H2,(H,25,28) |
| InChIKey | SCOCXGCBHYXMFQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |