C20H19N3O4 — CID 7270722
[2-(3-methylanilino)-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate (PubChem CID 7270722) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7270722 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCn1nc(C(=O)OCC(=O)Nc2cccc(C)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H19N3O4/c1-3-23-19(25)16-10-5-4-9-15(16)18(22-23)20(26)27-12-17(24)21-14-8-6-7-13(2)11-14/h4-11H,3,12H2,1-2H3,(H,21,24) |
| InChIKey | LBJJJRUDZJJJCP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |