C24H28N4O4 — CID 16502552
[2-[4-(diethylamino)anilino]-2-oxoethyl] 4-oxo-3-propylphthalazine-1-carboxylate (PubChem CID 16502552) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is [2-[4-(diethylamino)anilino]-2-oxoethyl] 4-oxo-3-propylphthalazine-1-carboxylate.
| Compound Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 4-oxo-3-propylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 16502552 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 4-oxo-3-propylphthalazine-1-carboxylate |
| SMILES | CCCn1nc(C(=O)OCC(=O)Nc2ccc(N(CC)CC)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H28N4O4/c1-4-15-28-23(30)20-10-8-7-9-19(20)22(26-28)24(31)32-16-21(29)25-17-11-13-18(14-12-17)27(5-2)6-3/h7-14H,4-6,15-16H2,1-3H3,(H,25,29) |
| InChIKey | GDFVKDLCEJGCSS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|