C29H30N4O4 — CID 16502530
[2-(4-anilino-N-propan-2-ylanilino)-2-oxoethyl] 4-oxo-3-propylphthalazine-1-carboxylate (PubChem CID 16502530) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is [2-(4-anilino-N-propan-2-ylanilino)-2-oxoethyl] 4-oxo-3-propylphthalazine-1-carboxylate.
| Compound Name | [2-(4-anilino-N-propan-2-ylanilino)-2-oxoethyl] 4-oxo-3-propylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 16502530 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | [2-(4-anilino-N-propan-2-ylanilino)-2-oxoethyl] 4-oxo-3-propylphthalazine-1-carboxylate |
| SMILES | CCCn1nc(C(=O)OCC(=O)N(c2ccc(Nc3ccccc3)cc2)C(C)C)c2ccccc2c1=O |
| InChI | InChI=1S/C29H30N4O4/c1-4-18-32-28(35)25-13-9-8-12-24(25)27(31-32)29(36)37-19-26(34)33(20(2)3)23-16-14-22(15-17-23)30-21-10-6-5-7-11-21/h5-17,20,30H,4,18-19H2,1-3H3 |
| InChIKey | PMHNJLPPKZJFHO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |