C23H24N2O4 — CID 3922518
phenacyl 3-hexyl-4-oxophthalazine-1-carboxylate (PubChem CID 3922518) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is phenacyl 3-hexyl-4-oxophthalazine-1-carboxylate.
| Compound Name | phenacyl 3-hexyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 3922518 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | phenacyl 3-hexyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCCCn1nc(C(=O)OCC(=O)c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H24N2O4/c1-2-3-4-10-15-25-22(27)19-14-9-8-13-18(19)21(24-25)23(28)29-16-20(26)17-11-6-5-7-12-17/h5-9,11-14H,2-4,10,15-16H2,1H3 |
| InChIKey | ROUNHJBYHJRKDA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|