C22H19F3N2O4 — CID 42984427
[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] 3-butyl-4-oxophthalazine-1-carboxylate (PubChem CID 42984427) has the molecular formula C22H19F3N2O4 and a molecular weight of 432.40 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] 3-butyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] 3-butyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 42984427 |
| Molecular Formula | C22H19F3N2O4 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] 3-butyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCn1nc(C(=O)OCC(=O)c2cccc(C(F)(F)F)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H19F3N2O4/c1-2-3-11-27-20(29)17-10-5-4-9-16(17)19(26-27)21(30)31-13-18(28)14-7-6-8-15(12-14)22(23,24)25/h4-10,12H,2-3,11,13H2,1H3 |
| InChIKey | PIOUIUGNMDYWKH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |