C24H26N2O6 — CID 2533328
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 2533328) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2533328 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OCC(=O)c2ccc(OC)c(OC)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H26N2O6/c1-4-5-8-13-26-23(28)18-10-7-6-9-17(18)22(25-26)24(29)32-15-19(27)16-11-12-20(30-2)21(14-16)31-3/h6-7,9-12,14H,4-5,8,13,15H2,1-3H3 |
| InChIKey | SRYIRZXBCQCTLI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|