C23H23BrN4O5 — CID 16543603
[2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 16543603) has the molecular formula C23H23BrN4O5 and a molecular weight of 515.36 g/mol. Its IUPAC name is [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 16543603 |
| Molecular Formula | C23H23BrN4O5 |
| Molecular Weight | 515.36 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OCC(=O)NNC(=O)c2ccc(Br)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H23BrN4O5/c1-2-3-6-13-28-22(31)18-8-5-4-7-17(18)20(27-28)23(32)33-14-19(29)25-26-21(30)15-9-11-16(24)12-10-15/h4-5,7-12H,2-3,6,13-14H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | LGCOVAFNZCVWAH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|