C29H27N3O5 — CID 55378702
[2-(4-benzamidophenyl)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 55378702) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 55378702 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OCC(=O)c2ccc(NC(=O)c3ccccc3)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C29H27N3O5/c1-2-3-9-18-32-28(35)24-13-8-7-12-23(24)26(31-32)29(36)37-19-25(33)20-14-16-22(17-15-20)30-27(34)21-10-5-4-6-11-21/h4-8,10-17H,2-3,9,18-19H2,1H3,(H,30,34) |
| InChIKey | KDFRDSJNSQXHSQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|