C24H27N3O4 — CID 7926446
ethyl 4-[(3-hexyl-4-oxophthalazine-1-carbonyl)amino]benzoate (PubChem CID 7926446) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is ethyl 4-[(3-hexyl-4-oxophthalazine-1-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(3-hexyl-4-oxophthalazine-1-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 7926446 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | ethyl 4-[(3-hexyl-4-oxophthalazine-1-carbonyl)amino]benzoate |
| SMILES | CCCCCCn1nc(C(=O)Nc2ccc(C(=O)OCC)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H27N3O4/c1-3-5-6-9-16-27-23(29)20-11-8-7-10-19(20)21(26-27)22(28)25-18-14-12-17(13-15-18)24(30)31-4-2/h7-8,10-15H,3-6,9,16H2,1-2H3,(H,25,28) |
| InChIKey | RZVHAGRRCXSTNX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|