C25H30N4O3 — CID 55548029
N-[4-(3-methylbutanoylamino)phenyl]-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 55548029) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[4-(3-methylbutanoylamino)phenyl]-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N-[4-(3-methylbutanoylamino)phenyl]-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55548029 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[4-(3-methylbutanoylamino)phenyl]-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)Nc2ccc(NC(=O)CC(C)C)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H30N4O3/c1-4-5-8-15-29-25(32)21-10-7-6-9-20(21)23(28-29)24(31)27-19-13-11-18(12-14-19)26-22(30)16-17(2)3/h6-7,9-14,17H,4-5,8,15-16H2,1-3H3,(H,26,30)(H,27,31) |
| InChIKey | NXELNQVSLZPIMW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|