C21H20F3N3O3 — CID 7957140
4-oxo-3-pentyl-N-[4-(trifluoromethoxy)phenyl]phthalazine-1-carboxamide (PubChem CID 7957140) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is 4-oxo-3-pentyl-N-[4-(trifluoromethoxy)phenyl]phthalazine-1-carboxamide.
| Compound Name | 4-oxo-3-pentyl-N-[4-(trifluoromethoxy)phenyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 7957140 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-oxo-3-pentyl-N-[4-(trifluoromethoxy)phenyl]phthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H20F3N3O3/c1-2-3-6-13-27-20(29)17-8-5-4-7-16(17)18(26-27)19(28)25-14-9-11-15(12-10-14)30-21(22,23)24/h4-5,7-12H,2-3,6,13H2,1H3,(H,25,28) |
| InChIKey | ITWWANFULKADLO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|