C24H33N3O4 — CID 55325185
[2-(cyclooctylamino)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 55325185) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 55325185 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OCC(=O)NC2CCCCCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H33N3O4/c1-2-3-11-16-27-23(29)20-15-10-9-14-19(20)22(26-27)24(30)31-17-21(28)25-18-12-7-5-4-6-8-13-18/h9-10,14-15,18H,2-8,11-13,16-17H2,1H3,(H,25,28) |
| InChIKey | IZRRUTUSCWWLSQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|