C23H31N3O4 — CID 8731528
[(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-butyl-4-oxophthalazine-1-carboxylate (PubChem CID 8731528) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-butyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-butyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 8731528 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-butyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCn1nc(C(=O)O[C@H](C)C(=O)NC2CCCCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H31N3O4/c1-3-4-15-26-22(28)19-14-10-9-13-18(19)20(25-26)23(29)30-16(2)21(27)24-17-11-7-5-6-8-12-17/h9-10,13-14,16-17H,3-8,11-12,15H2,1-2H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | SBCCZSCAMJLNCK-MRXNPFEDSA-N |
| XLogP | 3.58 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |