C23H30N4O5 — CID 4666378
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate (PubChem CID 4666378) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 4666378 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCCCn1nc(C(=O)OCC(=O)NC(=O)NC2CCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H30N4O5/c1-2-3-4-9-14-27-21(29)18-13-8-7-12-17(18)20(26-27)22(30)32-15-19(28)25-23(31)24-16-10-5-6-11-16/h7-8,12-13,16H,2-6,9-11,14-15H2,1H3,(H2,24,25,28,31) |
| InChIKey | CQOFHDGIPRIWDE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|