C29H29N3O4 — CID 55325324
[1-oxo-1-(2-phenylanilino)propan-2-yl] 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 55325324) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is [1-oxo-1-(2-phenylanilino)propan-2-yl] 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 55325324 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OC(C)C(=O)Nc2ccccc2-c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C29H29N3O4/c1-3-4-12-19-32-28(34)24-17-9-8-16-23(24)26(31-32)29(35)36-20(2)27(33)30-25-18-11-10-15-22(25)21-13-6-5-7-14-21/h5-11,13-18,20H,3-4,12,19H2,1-2H3,(H,30,33) |
| InChIKey | HBDNQKSLQWSZSC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|