C20H18N4O6 — CID 7190070
[(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 3-ethyl-4-oxophthalazine-1-carboxylate (PubChem CID 7190070) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 3-ethyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 3-ethyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7190070 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 3-ethyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCn1nc(C(=O)O[C@H](C)C(=O)Nc2ccccc2[N+](=O)[O-])c2ccccc2c1=O |
| InChI | InChI=1S/C20H18N4O6/c1-3-23-19(26)14-9-5-4-8-13(14)17(22-23)20(27)30-12(2)18(25)21-15-10-6-7-11-16(15)24(28)29/h4-12H,3H2,1-2H3,(H,21,25)/t12-/m1/s1 |
| InChIKey | WONPOVIARJJGHD-GFCCVEGCSA-N |
| XLogP | 2.51 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|