C24H18N2O5 — CID 7786599
[(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] anthracene-9-carboxylate (PubChem CID 7786599) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] anthracene-9-carboxylate.
| Compound Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 7786599 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] anthracene-9-carboxylate |
| SMILES | C[C@@H](OC(=O)c1c2ccccc2cc2ccccc12)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18N2O5/c1-15(23(27)25-20-12-6-7-13-21(20)26(29)30)31-24(28)22-18-10-4-2-8-16(18)14-17-9-3-5-11-19(17)22/h2-15H,1H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | ALOXOMKBTCAYNA-OAHLLOKOSA-N |
| XLogP | 5.09 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|