C19H14ClN3O5 — CID 9009627
[(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-chloroquinoline-4-carboxylate (PubChem CID 9009627) has the molecular formula C19H14ClN3O5 and a molecular weight of 399.79 g/mol. Its IUPAC name is [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-chloroquinoline-4-carboxylate.
| Compound Name | [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-chloroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 9009627 |
| Molecular Formula | C19H14ClN3O5 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-chloroquinoline-4-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)nc2ccccc12)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14ClN3O5/c1-11(18(24)22-15-8-4-5-9-16(15)23(26)27)28-19(25)13-10-17(20)21-14-7-3-2-6-12(13)14/h2-11H,1H3,(H,22,24)/t11-/m0/s1 |
| InChIKey | YLUIBBVEVAICMS-NSHDSACASA-N |
| XLogP | 3.98 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|