C16H13FN2O5 — CID 8612386
[(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 3-fluorobenzoate (PubChem CID 8612386) has the molecular formula C16H13FN2O5 and a molecular weight of 332.29 g/mol. Its IUPAC name is [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 3-fluorobenzoate.
| Compound Name | [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 8612386 |
| Molecular Formula | C16H13FN2O5 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 3-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cccc(F)c1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13FN2O5/c1-10(24-16(21)11-5-4-6-12(17)9-11)15(20)18-13-7-2-3-8-14(13)19(22)23/h2-10H,1H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | ONJRGQYSCBHYPB-JTQLQIEISA-N |
| XLogP | 2.92 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|