C22H26N2O7 — CID 42974885
[1-(2-nitroanilino)-1-oxopropan-2-yl] 3-ethoxy-4-(2-methylpropoxy)benzoate (PubChem CID 42974885) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is [1-(2-nitroanilino)-1-oxopropan-2-yl] 3-ethoxy-4-(2-methylpropoxy)benzoate.
| Compound Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 3-ethoxy-4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 42974885 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 3-ethoxy-4-(2-methylpropoxy)benzoate |
| SMILES | CCOc1cc(C(=O)OC(C)C(=O)Nc2ccccc2[N+](=O)[O-])ccc1OCC(C)C |
| InChI | InChI=1S/C22H26N2O7/c1-5-29-20-12-16(10-11-19(20)30-13-14(2)3)22(26)31-15(4)21(25)23-17-8-6-7-9-18(17)24(27)28/h6-12,14-15H,5,13H2,1-4H3,(H,23,25) |
| InChIKey | FIZMNZGSLRIYHA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|