C19H20N2O6 — CID 46809257
[1-(3-methylanilino)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate (PubChem CID 46809257) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is [1-(3-methylanilino)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate.
| Compound Name | [1-(3-methylanilino)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 46809257 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [1-(3-methylanilino)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)OC(C)C(=O)Nc2cccc(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N2O6/c1-4-26-17-9-8-14(11-16(17)21(24)25)19(23)27-13(3)18(22)20-15-7-5-6-12(2)10-15/h5-11,13H,4H2,1-3H3,(H,20,22) |
| InChIKey | LBGNLTHIWUGOJM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|