C18H22N4O6 — CID 8973123
[(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 4-ethoxy-3-nitrobenzoate (PubChem CID 8973123) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 4-ethoxy-3-nitrobenzoate.
| Compound Name | [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 8973123 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)O[C@H](C)C(=O)Nc2c(C)nn(C)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O6/c1-6-27-15-8-7-13(9-14(15)22(25)26)18(24)28-12(4)17(23)19-16-10(2)20-21(5)11(16)3/h7-9,12H,6H2,1-5H3,(H,19,23)/t12-/m1/s1 |
| InChIKey | JUMVISDBXPBNDE-GFCCVEGCSA-N |
| XLogP | 2.53 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|