C14H16N2O8 — CID 9306209
[(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate (PubChem CID 9306209) has the molecular formula C14H16N2O8 and a molecular weight of 340.29 g/mol. Its IUPAC name is [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate.
| Compound Name | [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 9306209 |
| Molecular Formula | C14H16N2O8 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)O[C@H](C)C(=O)NC(=O)OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O8/c1-4-23-11-6-5-9(7-10(11)16(20)21)13(18)24-8(2)12(17)15-14(19)22-3/h5-8H,4H2,1-3H3,(H,15,17,19)/t8-/m1/s1 |
| InChIKey | QQLWWYWNBDCTTM-MRVPVSSYSA-N |
| XLogP | 1.42 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|