C17H16FN3O5 — CID 7257368
[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate (PubChem CID 7257368) has the molecular formula C17H16FN3O5 and a molecular weight of 361.33 g/mol. Its IUPAC name is [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate.
| Compound Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7257368 |
| Molecular Formula | C17H16FN3O5 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)O[C@H](C)C(=O)Nc2ccccc2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16FN3O5/c1-10(16(22)20-13-6-4-3-5-12(13)18)26-17(23)11-7-8-14(19-2)15(9-11)21(24)25/h3-10,19H,1-2H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | ISTMPPWCJDZNTQ-SNVBAGLBSA-N |
| XLogP | 2.96 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|