C18H15FN2O7 — CID 7778762
3-O-[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 7778762) has the molecular formula C18H15FN2O7 and a molecular weight of 390.32 g/mol. Its IUPAC name is 3-O-[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7778762 |
| Molecular Formula | C18H15FN2O7 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 3-O-[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)O[C@H](C)C(=O)Nc2ccccc2F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15FN2O7/c1-10(16(22)20-15-6-4-3-5-14(15)19)28-18(24)12-7-11(17(23)27-2)8-13(9-12)21(25)26/h3-10H,1-2H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | WFEOGCIIYFJSJH-SNVBAGLBSA-N |
| XLogP | 2.70 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|