C19H15F3N2O7 — CID 2649894
1-O-methyl 3-O-[(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 2649894) has the molecular formula C19H15F3N2O7 and a molecular weight of 440.33 g/mol. Its IUPAC name is 1-O-methyl 3-O-[(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-[(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2649894 |
| Molecular Formula | C19H15F3N2O7 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 1-O-methyl 3-O-[(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)O[C@H](C)C(=O)Nc2ccc(C(F)(F)F)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15F3N2O7/c1-10(16(25)23-14-5-3-13(4-6-14)19(20,21)22)31-18(27)12-7-11(17(26)30-2)8-15(9-12)24(28)29/h3-10H,1-2H3,(H,23,25)/t10-/m1/s1 |
| InChIKey | HKGNWJGKBFTNJQ-SNVBAGLBSA-N |
| XLogP | 3.58 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|