C14H8F3N3O5 — CID 9097997
3,5-dinitro-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 9097997) has the molecular formula C14H8F3N3O5 and a molecular weight of 355.23 g/mol. Its IUPAC name is 3,5-dinitro-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3,5-dinitro-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 9097997 |
| Molecular Formula | C14H8F3N3O5 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 3,5-dinitro-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8F3N3O5/c15-14(16,17)9-1-3-10(4-2-9)18-13(21)8-5-11(19(22)23)7-12(6-8)20(24)25/h1-7H,(H,18,21) |
| InChIKey | ZYPZHVLBCLHNPD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|