C21H14F3N3O4 — CID 1118911
4-[(4-nitrobenzoyl)amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 1118911) has the molecular formula C21H14F3N3O4 and a molecular weight of 429.35 g/mol. Its IUPAC name is 4-[(4-nitrobenzoyl)amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[(4-nitrobenzoyl)amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1118911 |
| Molecular Formula | C21H14F3N3O4 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 4-[(4-nitrobenzoyl)amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14F3N3O4/c22-21(23,24)15-2-1-3-17(12-15)26-20(29)13-4-8-16(9-5-13)25-19(28)14-6-10-18(11-7-14)27(30)31/h1-12H,(H,25,28)(H,26,29) |
| InChIKey | DHHMCEKWYGEFCD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|