C21H12N6O12 — CID 3958102
3,5-bis[(3,5-dinitrobenzoyl)amino]benzoic acid (PubChem CID 3958102) has the molecular formula C21H12N6O12 and a molecular weight of 540.36 g/mol. Its IUPAC name is 3,5-bis[(3,5-dinitrobenzoyl)amino]benzoic acid.
| Compound Name | 3,5-bis[(3,5-dinitrobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 3958102 |
| Molecular Formula | C21H12N6O12 |
| Molecular Weight | 540.36 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | 3,5-bis[(3,5-dinitrobenzoyl)amino]benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H12N6O12/c28-19(10-3-15(24(32)33)8-16(4-10)25(34)35)22-13-1-12(21(30)31)2-14(7-13)23-20(29)11-5-17(26(36)37)9-18(6-11)27(38)39/h1-9H,(H,22,28)(H,23,29)(H,30,31) |
| InChIKey | HQYYKSGTZFTRGC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 268.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|