C15H9ClN2O7 — CID 45428362
5-[(2-chloro-5-nitrobenzoyl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 45428362) has the molecular formula C15H9ClN2O7 and a molecular weight of 364.70 g/mol. Its IUPAC name is 5-[(2-chloro-5-nitrobenzoyl)amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(2-chloro-5-nitrobenzoyl)amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 45428362 |
| Molecular Formula | C15H9ClN2O7 |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 5-[(2-chloro-5-nitrobenzoyl)amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H9ClN2O7/c16-12-2-1-10(18(24)25)6-11(12)13(19)17-9-4-7(14(20)21)3-8(5-9)15(22)23/h1-6H,(H,17,19)(H,20,21)(H,22,23) |
| InChIKey | TUBAQRYVXRORMQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|